C14H20ClN3O5S — CID 75270012
ethyl 3-[(3-chloro-4-methoxyphenyl)sulfamoyl]-5-methylpyrazolidine-4-carboxylate (PubChem CID 75270012) has the molecular formula C14H20ClN3O5S and a molecular weight of 377.85 g/mol. Its IUPAC name is ethyl 3-[(3-chloro-4-methoxyphenyl)sulfamoyl]-5-methylpyrazolidine-4-carboxylate.
| Compound Name | ethyl 3-[(3-chloro-4-methoxyphenyl)sulfamoyl]-5-methylpyrazolidine-4-carboxylate |
|---|---|
| PubChem CID | 75270012 |
| Molecular Formula | C14H20ClN3O5S |
| Molecular Weight | 377.85 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | ethyl 3-[(3-chloro-4-methoxyphenyl)sulfamoyl]-5-methylpyrazolidine-4-carboxylate |
| SMILES | CCOC(=O)C1C(C)NNC1S(=O)(=O)Nc1ccc(OC)c(Cl)c1 |
| InChI | InChI=1S/C14H20ClN3O5S/c1-4-23-14(19)12-8(2)16-17-13(12)24(20,21)18-9-5-6-11(22-3)10(15)7-9/h5-8,12-13,16-18H,4H2,1-3H3 |
| InChIKey | CWGKDUUKJZXOJE-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.85 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |