C7H14N4O2S — CID 753006
ethyl 2-(3-methyl-6-sulfanylidene-1,2,4,5-tetrazinan-3-yl)acetate (PubChem CID 753006) has the molecular formula C7H14N4O2S and a molecular weight of 218.28 g/mol. Its IUPAC name is ethyl 2-(3-methyl-6-sulfanylidene-1,2,4,5-tetrazinan-3-yl)acetate.
| Compound Name | ethyl 2-(3-methyl-6-sulfanylidene-1,2,4,5-tetrazinan-3-yl)acetate |
|---|---|
| PubChem CID | 753006 |
| Molecular Formula | C7H14N4O2S |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | ethyl 2-(3-methyl-6-sulfanylidene-1,2,4,5-tetrazinan-3-yl)acetate |
| SMILES | CCOC(=O)CC1(C)NNC(=S)NN1 |
| InChI | InChI=1S/C7H14N4O2S/c1-3-13-5(12)4-7(2)10-8-6(14)9-11-7/h10-11H,3-4H2,1-2H3,(H2,8,9,14) |
| InChIKey | ZAQNDIWLVBYWHF-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 74.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_urea_F(6)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|