C22H42N4O4 — CID 70491269
2-[2-(2,4,4,5,5-pentamethylimidazolidin-2-yl)acetyl]oxyethyl 2-(2,4,4,5,5-pentamethylimidazolidin-2-yl)acetate (PubChem CID 70491269) has the molecular formula C22H42N4O4 and a molecular weight of 426.60 g/mol. Its IUPAC name is 2-[2-(2,4,4,5,5-pentamethylimidazolidin-2-yl)acetyl]oxyethyl 2-(2,4,4,5,5-pentamethylimidazolidin-2-yl)acetate.
| Compound Name | 2-[2-(2,4,4,5,5-pentamethylimidazolidin-2-yl)acetyl]oxyethyl 2-(2,4,4,5,5-pentamethylimidazolidin-2-yl)acetate |
|---|---|
| PubChem CID | 70491269 |
| Molecular Formula | C22H42N4O4 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.32 |
| IUPAC Name | 2-[2-(2,4,4,5,5-pentamethylimidazolidin-2-yl)acetyl]oxyethyl 2-(2,4,4,5,5-pentamethylimidazolidin-2-yl)acetate |
| SMILES | CC1(CC(=O)OCCOC(=O)CC2(C)NC(C)(C)C(C)(C)N2)NC(C)(C)C(C)(C)N1 |
| InChI | InChI=1S/C22H42N4O4/c1-17(2)18(3,4)24-21(9,23-17)13-15(27)29-11-12-30-16(28)14-22(10)25-19(5,6)20(7,8)26-22/h23-26H,11-14H2,1-10H3 |
| InChIKey | NNCXZDAGUVUYJV-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|