C17H21FN2O2S2 — CID 7530805
N-[2-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]ethyl]cyclohexanesulfonamide (PubChem CID 7530805) has the molecular formula C17H21FN2O2S2 and a molecular weight of 368.50 g/mol. Its IUPAC name is N-[2-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]ethyl]cyclohexanesulfonamide.
| Compound Name | N-[2-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]ethyl]cyclohexanesulfonamide |
|---|---|
| PubChem CID | 7530805 |
| Molecular Formula | C17H21FN2O2S2 |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | N-[2-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]ethyl]cyclohexanesulfonamide |
| SMILES | O=S(=O)(NCCc1csc(-c2cccc(F)c2)n1)C1CCCCC1 |
| InChI | InChI=1S/C17H21FN2O2S2/c18-14-6-4-5-13(11-14)17-20-15(12-23-17)9-10-19-24(21,22)16-7-2-1-3-8-16/h4-6,11-12,16,19H,1-3,7-10H2 |
| InChIKey | OFRHSJUDWHIJDE-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |