C17H19NO5S2 — CID 7534901
(2R)-2-[(5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-2-oxo-4-sulfanylidene-1,3-thiazolidin-3-yl]-3-methylbutanoic acid (PubChem CID 7534901) has the molecular formula C17H19NO5S2 and a molecular weight of 381.48 g/mol. Its IUPAC name is (2R)-2-[(5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-2-oxo-4-sulfanylidene-1,3-thiazolidin-3-yl]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[(5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-2-oxo-4-sulfanylidene-1,3-thiazolidin-3-yl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 7534901 |
| Molecular Formula | C17H19NO5S2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | (2R)-2-[(5Z)-5-[(3,4-dimethoxyphenyl)methylidene]-2-oxo-4-sulfanylidene-1,3-thiazolidin-3-yl]-3-methylbutanoic acid |
| SMILES | COc1ccc(/C=C2\SC(=O)N([C@@H](C(=O)O)C(C)C)C2=S)cc1OC |
| InChI | InChI=1S/C17H19NO5S2/c1-9(2)14(16(19)20)18-15(24)13(25-17(18)21)8-10-5-6-11(22-3)12(7-10)23-4/h5-9,14H,1-4H3,(H,19,20)/b13-8-/t14-/m1/s1 |
| InChIKey | IETKGPSICQYDQT-YLHGKKIISA-N |
| XLogP | 3.65 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_E(8)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|