C18H16N2O5S3 — CID 4755307
N-[5-[(3,4-dimethoxyphenyl)methylidene]-2-oxo-4-sulfanylidene-1,3-thiazolidin-3-yl]benzenesulfonamide (PubChem CID 4755307) has the molecular formula C18H16N2O5S3 and a molecular weight of 436.54 g/mol. Its IUPAC name is N-[5-[(3,4-dimethoxyphenyl)methylidene]-2-oxo-4-sulfanylidene-1,3-thiazolidin-3-yl]benzenesulfonamide.
| Compound Name | N-[5-[(3,4-dimethoxyphenyl)methylidene]-2-oxo-4-sulfanylidene-1,3-thiazolidin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 4755307 |
| Molecular Formula | C18H16N2O5S3 |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.02 |
| IUPAC Name | N-[5-[(3,4-dimethoxyphenyl)methylidene]-2-oxo-4-sulfanylidene-1,3-thiazolidin-3-yl]benzenesulfonamide |
| SMILES | COc1ccc(C=C2SC(=O)N(NS(=O)(=O)c3ccccc3)C2=S)cc1OC |
| InChI | InChI=1S/C18H16N2O5S3/c1-24-14-9-8-12(10-15(14)25-2)11-16-17(26)20(18(21)27-16)19-28(22,23)13-6-4-3-5-7-13/h3-11,19H,1-2H3 |
| InChIKey | YZUABYFVZCMEQE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_E(8)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|