C15H14ClN3O — CID 75362257
2-(4-chlorophenyl)-N-[(Z)-2,3-dihydropyrrolizin-1-ylideneamino]acetamide (PubChem CID 75362257) has the molecular formula C15H14ClN3O and a molecular weight of 287.75 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[(Z)-2,3-dihydropyrrolizin-1-ylideneamino]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[(Z)-2,3-dihydropyrrolizin-1-ylideneamino]acetamide |
|---|---|
| PubChem CID | 75362257 |
| Molecular Formula | C15H14ClN3O |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[(Z)-2,3-dihydropyrrolizin-1-ylideneamino]acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1)N/N=C1/CCn2cccc21 |
| InChI | InChI=1S/C15H14ClN3O/c16-12-5-3-11(4-6-12)10-15(20)18-17-13-7-9-19-8-1-2-14(13)19/h1-6,8H,7,9-10H2,(H,18,20)/b17-13- |
| InChIKey | SJJNPUNVXGXOKE-LGMDPLHJSA-N |
| XLogP | 2.61 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|