C19H20N2O3 — CID 75364562
(E)-3-(2,3-dihydro-1-benzofuran-5-yl)-N-ethyl-N-(6-methoxy-3-pyridinyl)prop-2-enamide (PubChem CID 75364562) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is (E)-3-(2,3-dihydro-1-benzofuran-5-yl)-N-ethyl-N-(6-methoxy-3-pyridinyl)prop-2-enamide.
| Compound Name | (E)-3-(2,3-dihydro-1-benzofuran-5-yl)-N-ethyl-N-(6-methoxy-3-pyridinyl)prop-2-enamide |
|---|---|
| PubChem CID | 75364562 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | (E)-3-(2,3-dihydro-1-benzofuran-5-yl)-N-ethyl-N-(6-methoxy-3-pyridinyl)prop-2-enamide |
| SMILES | CCN(C(=O)/C=C/c1ccc2c(c1)CCO2)c1ccc(OC)nc1 |
| InChI | InChI=1S/C19H20N2O3/c1-3-21(16-6-8-18(23-2)20-13-16)19(22)9-5-14-4-7-17-15(12-14)10-11-24-17/h4-9,12-13H,3,10-11H2,1-2H3/b9-5+ |
| InChIKey | UVTFYSLRUUFEPX-WEVVVXLNSA-N |
| XLogP | 3.09 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|