C19H16F3NO2 — CID 154797024
3-(2,3-dihydro-1-benzofuran-5-yl)-N-phenyl-N-(2,2,2-trifluoroethyl)prop-2-enamide (PubChem CID 154797024) has the molecular formula C19H16F3NO2 and a molecular weight of 347.34 g/mol. Its IUPAC name is 3-(2,3-dihydro-1-benzofuran-5-yl)-N-phenyl-N-(2,2,2-trifluoroethyl)prop-2-enamide.
| Compound Name | 3-(2,3-dihydro-1-benzofuran-5-yl)-N-phenyl-N-(2,2,2-trifluoroethyl)prop-2-enamide |
|---|---|
| PubChem CID | 154797024 |
| Molecular Formula | C19H16F3NO2 |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 3-(2,3-dihydro-1-benzofuran-5-yl)-N-phenyl-N-(2,2,2-trifluoroethyl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccc2c(c1)CCO2)N(CC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C19H16F3NO2/c20-19(21,22)13-23(16-4-2-1-3-5-16)18(24)9-7-14-6-8-17-15(12-14)10-11-25-17/h1-9,12H,10-11,13H2 |
| InChIKey | VDUWQRAVEGTBJY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|