C19H20N2O5S — CID 75367764
2-[(6R)-6-(4-methylsulfonylphenoxy)-1,4-oxazepan-4-yl]-1,3-benzoxazole (PubChem CID 75367764) has the molecular formula C19H20N2O5S and a molecular weight of 388.45 g/mol. Its IUPAC name is 2-[(6R)-6-(4-methylsulfonylphenoxy)-1,4-oxazepan-4-yl]-1,3-benzoxazole.
| Compound Name | 2-[(6R)-6-(4-methylsulfonylphenoxy)-1,4-oxazepan-4-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 75367764 |
| Molecular Formula | C19H20N2O5S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 2-[(6R)-6-(4-methylsulfonylphenoxy)-1,4-oxazepan-4-yl]-1,3-benzoxazole |
| SMILES | CS(=O)(=O)c1ccc(O[C@H]2COCCN(c3nc4ccccc4o3)C2)cc1 |
| InChI | InChI=1S/C19H20N2O5S/c1-27(22,23)16-8-6-14(7-9-16)25-15-12-21(10-11-24-13-15)19-20-17-4-2-3-5-18(17)26-19/h2-9,15H,10-13H2,1H3/t15-/m1/s1 |
| InChIKey | WZNPZOQOAOQFMR-OAHLLOKOSA-N |
| XLogP | 2.52 |
| TPSA | 81.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |