C16H25NO4S — CID 75371938
1-[2-(furan-2-yl)piperidin-1-yl]-3-(2-methylpropylsulfonyl)propan-1-one (PubChem CID 75371938) has the molecular formula C16H25NO4S and a molecular weight of 327.45 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)piperidin-1-yl]-3-(2-methylpropylsulfonyl)propan-1-one.
| Compound Name | 1-[2-(furan-2-yl)piperidin-1-yl]-3-(2-methylpropylsulfonyl)propan-1-one |
|---|---|
| PubChem CID | 75371938 |
| Molecular Formula | C16H25NO4S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 1-[2-(furan-2-yl)piperidin-1-yl]-3-(2-methylpropylsulfonyl)propan-1-one |
| SMILES | CC(C)CS(=O)(=O)CCC(=O)N1CCCCC1c1ccco1 |
| InChI | InChI=1S/C16H25NO4S/c1-13(2)12-22(19,20)11-8-16(18)17-9-4-3-6-14(17)15-7-5-10-21-15/h5,7,10,13-14H,3-4,6,8-9,11-12H2,1-2H3 |
| InChIKey | WEMICXJEROONTL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |