C17H25N5OS — CID 75374593
1-[4-[2-(dimethylamino)ethylsulfanyl]phenyl]-3-[1-(1-methylpyrazol-4-yl)ethyl]urea (PubChem CID 75374593) has the molecular formula C17H25N5OS and a molecular weight of 347.49 g/mol. Its IUPAC name is 1-[4-[2-(dimethylamino)ethylsulfanyl]phenyl]-3-[1-(1-methylpyrazol-4-yl)ethyl]urea.
| Compound Name | 1-[4-[2-(dimethylamino)ethylsulfanyl]phenyl]-3-[1-(1-methylpyrazol-4-yl)ethyl]urea |
|---|---|
| PubChem CID | 75374593 |
| Molecular Formula | C17H25N5OS |
| Molecular Weight | 347.49 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 1-[4-[2-(dimethylamino)ethylsulfanyl]phenyl]-3-[1-(1-methylpyrazol-4-yl)ethyl]urea |
| SMILES | CC(NC(=O)Nc1ccc(SCCN(C)C)cc1)c1cnn(C)c1 |
| InChI | InChI=1S/C17H25N5OS/c1-13(14-11-18-22(4)12-14)19-17(23)20-15-5-7-16(8-6-15)24-10-9-21(2)3/h5-8,11-13H,9-10H2,1-4H3,(H2,19,20,23) |
| InChIKey | DBTAPODHRPOGHG-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.49 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |