C18H31N5O2 — CID 75376554
1-tert-butyl-3-[1-[1-(2-ethyl-1H-imidazole-5-carbonyl)piperidin-3-yl]ethyl]urea (PubChem CID 75376554) has the molecular formula C18H31N5O2 and a molecular weight of 349.48 g/mol. Its IUPAC name is 1-tert-butyl-3-[1-[1-(2-ethyl-1H-imidazole-5-carbonyl)piperidin-3-yl]ethyl]urea.
| Compound Name | 1-tert-butyl-3-[1-[1-(2-ethyl-1H-imidazole-5-carbonyl)piperidin-3-yl]ethyl]urea |
|---|---|
| PubChem CID | 75376554 |
| Molecular Formula | C18H31N5O2 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.25 |
| IUPAC Name | 1-tert-butyl-3-[1-[1-(2-ethyl-1H-imidazole-5-carbonyl)piperidin-3-yl]ethyl]urea |
| SMILES | CCc1ncc(C(=O)N2CCCC(C(C)NC(=O)NC(C)(C)C)C2)[nH]1 |
| InChI | InChI=1S/C18H31N5O2/c1-6-15-19-10-14(21-15)16(24)23-9-7-8-13(11-23)12(2)20-17(25)22-18(3,4)5/h10,12-13H,6-9,11H2,1-5H3,(H,19,21)(H2,20,22,25) |
| InChIKey | VWEKRFWVOHLVIH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |