C15H25N5O2S — CID 97086141
1-tert-butyl-3-[(1S)-1-[(3S)-1-(thiadiazole-5-carbonyl)piperidin-3-yl]ethyl]urea (PubChem CID 97086141) has the molecular formula C15H25N5O2S and a molecular weight of 339.47 g/mol. Its IUPAC name is 1-tert-butyl-3-[(1S)-1-[(3S)-1-(thiadiazole-5-carbonyl)piperidin-3-yl]ethyl]urea.
| Compound Name | 1-tert-butyl-3-[(1S)-1-[(3S)-1-(thiadiazole-5-carbonyl)piperidin-3-yl]ethyl]urea |
|---|---|
| PubChem CID | 97086141 |
| Molecular Formula | C15H25N5O2S |
| Molecular Weight | 339.47 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 1-tert-butyl-3-[(1S)-1-[(3S)-1-(thiadiazole-5-carbonyl)piperidin-3-yl]ethyl]urea |
| SMILES | C[C@H](NC(=O)NC(C)(C)C)[C@H]1CCCN(C(=O)c2cnns2)C1 |
| InChI | InChI=1S/C15H25N5O2S/c1-10(17-14(22)18-15(2,3)4)11-6-5-7-20(9-11)13(21)12-8-16-19-23-12/h8,10-11H,5-7,9H2,1-4H3,(H2,17,18,22)/t10-,11-/m0/s1 |
| InChIKey | KBUQSCZXVSQRTD-QWRGUYRKSA-N |
| XLogP | 1.88 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.47 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |