C19H28FN3O2 — CID 95632703
1-tert-butyl-3-[(1S)-1-[(3R)-1-(2-fluorobenzoyl)piperidin-3-yl]ethyl]urea (PubChem CID 95632703) has the molecular formula C19H28FN3O2 and a molecular weight of 349.45 g/mol. Its IUPAC name is 1-tert-butyl-3-[(1S)-1-[(3R)-1-(2-fluorobenzoyl)piperidin-3-yl]ethyl]urea.
| Compound Name | 1-tert-butyl-3-[(1S)-1-[(3R)-1-(2-fluorobenzoyl)piperidin-3-yl]ethyl]urea |
|---|---|
| PubChem CID | 95632703 |
| Molecular Formula | C19H28FN3O2 |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | 1-tert-butyl-3-[(1S)-1-[(3R)-1-(2-fluorobenzoyl)piperidin-3-yl]ethyl]urea |
| SMILES | C[C@H](NC(=O)NC(C)(C)C)[C@@H]1CCCN(C(=O)c2ccccc2F)C1 |
| InChI | InChI=1S/C19H28FN3O2/c1-13(21-18(25)22-19(2,3)4)14-8-7-11-23(12-14)17(24)15-9-5-6-10-16(15)20/h5-6,9-10,13-14H,7-8,11-12H2,1-4H3,(H2,21,22,25)/t13-,14+/m0/s1 |
| InChIKey | FRNPEYPFMIUCOE-UONOGXRCSA-N |
| XLogP | 3.16 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |