C18H26ClN3O — CID 75378798
2-chloro-4-[(4-cyano-4-methylpentyl)amino]-N-(2-methylpropyl)benzamide (PubChem CID 75378798) has the molecular formula C18H26ClN3O and a molecular weight of 335.88 g/mol. Its IUPAC name is 2-chloro-4-[(4-cyano-4-methylpentyl)amino]-N-(2-methylpropyl)benzamide.
| Compound Name | 2-chloro-4-[(4-cyano-4-methylpentyl)amino]-N-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 75378798 |
| Molecular Formula | C18H26ClN3O |
| Molecular Weight | 335.88 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 2-chloro-4-[(4-cyano-4-methylpentyl)amino]-N-(2-methylpropyl)benzamide |
| SMILES | CC(C)CNC(=O)c1ccc(NCCCC(C)(C)C#N)cc1Cl |
| InChI | InChI=1S/C18H26ClN3O/c1-13(2)11-22-17(23)15-7-6-14(10-16(15)19)21-9-5-8-18(3,4)12-20/h6-7,10,13,21H,5,8-9,11H2,1-4H3,(H,22,23) |
| InChIKey | UUIJSORTMGJDEI-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.88 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|