C16H22Cl2N2O2 — CID 149456189
2,4-dichloro-N-[5-(2-methylpropylamino)-5-oxopentyl]benzamide (PubChem CID 149456189) has the molecular formula C16H22Cl2N2O2 and a molecular weight of 345.27 g/mol. Its IUPAC name is 2,4-dichloro-N-[5-(2-methylpropylamino)-5-oxopentyl]benzamide.
| Compound Name | 2,4-dichloro-N-[5-(2-methylpropylamino)-5-oxopentyl]benzamide |
|---|---|
| PubChem CID | 149456189 |
| Molecular Formula | C16H22Cl2N2O2 |
| Molecular Weight | 345.27 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 2,4-dichloro-N-[5-(2-methylpropylamino)-5-oxopentyl]benzamide |
| SMILES | CC(C)CNC(=O)CCCCNC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H22Cl2N2O2/c1-11(2)10-20-15(21)5-3-4-8-19-16(22)13-7-6-12(17)9-14(13)18/h6-7,9,11H,3-5,8,10H2,1-2H3,(H,19,22)(H,20,21) |
| InChIKey | YYPHCOCMQDATIT-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.27 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|