About 4-[(2,4-difluorophenyl)methylsulfinyl]-N,N-dimethylbutanamide
4-[(2,4-difluorophenyl)methylsulfinyl]-N,N-dimethylbutanamide (PubChem CID 75380076) has the molecular formula C13H17F2NO2S
and a molecular weight of 289.35 g/mol. Its IUPAC name is 4-[(2,4-difluorophenyl)methylsulfinyl]-N,N-dimethylbutanamide.
Molecular Properties
| Compound Name | 4-[(2,4-difluorophenyl)methylsulfinyl]-N,N-dimethylbutanamide |
| PubChem CID | 75380076 |
| Molecular Formula | C13H17F2NO2S |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 4-[(2,4-difluorophenyl)methylsulfinyl]-N,N-dimethylbutanamide |
| SMILES | CN(C)C(=O)CCCS(=O)Cc1ccc(F)cc1F |
| InChI | InChI=1S/C13H17F2NO2S/c1-16(2)13(17)4-3-7-19(18)9-10-5-6-11(14)8-12(10)15/h5-6,8H,3-4,7,9H2,1-2H3 |
| InChIKey | JBVAKRBGCUZBRR-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(2,4-difluorophenyl)methylsulfinyl]-N,N-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,4-difluorophenyl)methylsulfinyl]-N,N-dimethylbutanamide?
The IUPAC name of 4-[(2,4-difluorophenyl)methylsulfinyl]-N,N-dimethylbutanamide (CID 75380076) is 4-[(2,4-difluorophenyl)methylsulfinyl]-N,N-dimethylbutanamide.
What is the SMILES notation for 4-[(2,4-difluorophenyl)methylsulfinyl]-N,N-dimethylbutanamide?
The canonical SMILES for 4-[(2,4-difluorophenyl)methylsulfinyl]-N,N-dimethylbutanamide is CN(C)C(=O)CCCS(=O)Cc1ccc(F)cc1F.
What is the InChIKey of 4-[(2,4-difluorophenyl)methylsulfinyl]-N,N-dimethylbutanamide?
The InChIKey is JBVAKRBGCUZBRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17F2NO2S/c1-16(2)13(17)4-3-7-19(18)9-10-5-6-11(14)8-12(10)15/h5-6,8H,3-4,7,9H2,1-2H3.
What are the key properties of 4-[(2,4-difluorophenyl)methylsulfinyl]-N,N-dimethylbutanamide?
4-[(2,4-difluorophenyl)methylsulfinyl]-N,N-dimethylbutanamide has a molecular weight of 289.35 g/mol, XLogP of 2.08, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,4-difluorophenyl)methylsulfinyl]-N,N-dimethylbutanamide is sourced from PubChem (CID 75380076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).