C11H12ClFN2O3 — CID 75391958
N-(1-amino-3-methoxy-1-oxopropan-2-yl)-3-chloro-2-fluorobenzamide (PubChem CID 75391958) has the molecular formula C11H12ClFN2O3 and a molecular weight of 274.68 g/mol. Its IUPAC name is N-(1-amino-3-methoxy-1-oxopropan-2-yl)-3-chloro-2-fluorobenzamide.
| Compound Name | N-(1-amino-3-methoxy-1-oxopropan-2-yl)-3-chloro-2-fluorobenzamide |
|---|---|
| PubChem CID | 75391958 |
| Molecular Formula | C11H12ClFN2O3 |
| Molecular Weight | 274.68 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | N-(1-amino-3-methoxy-1-oxopropan-2-yl)-3-chloro-2-fluorobenzamide |
| SMILES | COCC(NC(=O)c1cccc(Cl)c1F)C(N)=O |
| InChI | InChI=1S/C11H12ClFN2O3/c1-18-5-8(10(14)16)15-11(17)6-3-2-4-7(12)9(6)13/h2-4,8H,5H2,1H3,(H2,14,16)(H,15,17) |
| InChIKey | KHLJGCOCWRPBCP-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.68 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |