C20H17N3O4S — CID 75394046
methyl 3-(1,3-dioxoisoindol-2-yl)-2-(1-methylbenzimidazol-2-yl)sulfanylpropanoate (PubChem CID 75394046) has the molecular formula C20H17N3O4S and a molecular weight of 395.44 g/mol. Its IUPAC name is methyl 3-(1,3-dioxoisoindol-2-yl)-2-(1-methylbenzimidazol-2-yl)sulfanylpropanoate.
| Compound Name | methyl 3-(1,3-dioxoisoindol-2-yl)-2-(1-methylbenzimidazol-2-yl)sulfanylpropanoate |
|---|---|
| PubChem CID | 75394046 |
| Molecular Formula | C20H17N3O4S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | methyl 3-(1,3-dioxoisoindol-2-yl)-2-(1-methylbenzimidazol-2-yl)sulfanylpropanoate |
| SMILES | COC(=O)C(CN1C(=O)c2ccccc2C1=O)Sc1nc2ccccc2n1C |
| InChI | InChI=1S/C20H17N3O4S/c1-22-15-10-6-5-9-14(15)21-20(22)28-16(19(26)27-2)11-23-17(24)12-7-3-4-8-13(12)18(23)25/h3-10,16H,11H2,1-2H3 |
| InChIKey | QALPBQDYBYWHQJ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|