C21H20ClN3O3S — CID 75396246
[2-[[(4-ethylphenyl)-thiophen-2-ylmethyl]amino]-2-oxoethyl] 5-amino-6-chloropyridine-3-carboxylate (PubChem CID 75396246) has the molecular formula C21H20ClN3O3S and a molecular weight of 429.93 g/mol. Its IUPAC name is [2-[[(4-ethylphenyl)-thiophen-2-ylmethyl]amino]-2-oxoethyl] 5-amino-6-chloropyridine-3-carboxylate.
| Compound Name | [2-[[(4-ethylphenyl)-thiophen-2-ylmethyl]amino]-2-oxoethyl] 5-amino-6-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 75396246 |
| Molecular Formula | C21H20ClN3O3S |
| Molecular Weight | 429.93 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | [2-[[(4-ethylphenyl)-thiophen-2-ylmethyl]amino]-2-oxoethyl] 5-amino-6-chloropyridine-3-carboxylate |
| SMILES | CCc1ccc(C(NC(=O)COC(=O)c2cnc(Cl)c(N)c2)c2cccs2)cc1 |
| InChI | InChI=1S/C21H20ClN3O3S/c1-2-13-5-7-14(8-6-13)19(17-4-3-9-29-17)25-18(26)12-28-21(27)15-10-16(23)20(22)24-11-15/h3-11,19H,2,12,23H2,1H3,(H,25,26) |
| InChIKey | XVSBHXLVVLKGSM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.93 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|