C16H20FNO3S — CID 75407686
(E)-3-(3-fluorophenyl)-N-(3-methylsulfonylcyclohexyl)prop-2-enamide (PubChem CID 75407686) has the molecular formula C16H20FNO3S and a molecular weight of 325.40 g/mol. Its IUPAC name is (E)-3-(3-fluorophenyl)-N-(3-methylsulfonylcyclohexyl)prop-2-enamide.
| Compound Name | (E)-3-(3-fluorophenyl)-N-(3-methylsulfonylcyclohexyl)prop-2-enamide |
|---|---|
| PubChem CID | 75407686 |
| Molecular Formula | C16H20FNO3S |
| Molecular Weight | 325.40 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | (E)-3-(3-fluorophenyl)-N-(3-methylsulfonylcyclohexyl)prop-2-enamide |
| SMILES | CS(=O)(=O)C1CCCC(NC(=O)/C=C/c2cccc(F)c2)C1 |
| InChI | InChI=1S/C16H20FNO3S/c1-22(20,21)15-7-3-6-14(11-15)18-16(19)9-8-12-4-2-5-13(17)10-12/h2,4-5,8-10,14-15H,3,6-7,11H2,1H3,(H,18,19)/b9-8+ |
| InChIKey | NWBQEIWKLPHXSN-CMDGGOBGSA-N |
| XLogP | 2.31 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.40 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|