C17H26N2O4 — CID 75408320
tert-butyl N-[4-[furan-2-carbonyl(methyl)amino]cyclohexyl]carbamate (PubChem CID 75408320) has the molecular formula C17H26N2O4 and a molecular weight of 322.40 g/mol. Its IUPAC name is tert-butyl N-[4-[furan-2-carbonyl(methyl)amino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[furan-2-carbonyl(methyl)amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 75408320 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | tert-butyl N-[4-[furan-2-carbonyl(methyl)amino]cyclohexyl]carbamate |
| SMILES | CN(C(=O)c1ccco1)C1CCC(NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C17H26N2O4/c1-17(2,3)23-16(21)18-12-7-9-13(10-8-12)19(4)15(20)14-6-5-11-22-14/h5-6,11-13H,7-10H2,1-4H3,(H,18,21) |
| InChIKey | VTGIVRNVCHROPH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |