C18H17ClN2O5S — CID 75417144
(2,5-dimethyl-4-nitrophenyl) 1-(5-chlorothiophene-2-carbonyl)pyrrolidine-2-carboxylate (PubChem CID 75417144) has the molecular formula C18H17ClN2O5S and a molecular weight of 408.86 g/mol. Its IUPAC name is (2,5-dimethyl-4-nitrophenyl) 1-(5-chlorothiophene-2-carbonyl)pyrrolidine-2-carboxylate.
| Compound Name | (2,5-dimethyl-4-nitrophenyl) 1-(5-chlorothiophene-2-carbonyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 75417144 |
| Molecular Formula | C18H17ClN2O5S |
| Molecular Weight | 408.86 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | (2,5-dimethyl-4-nitrophenyl) 1-(5-chlorothiophene-2-carbonyl)pyrrolidine-2-carboxylate |
| SMILES | Cc1cc([N+](=O)[O-])c(C)cc1OC(=O)C1CCCN1C(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C18H17ClN2O5S/c1-10-9-14(11(2)8-13(10)21(24)25)26-18(23)12-4-3-7-20(12)17(22)15-5-6-16(19)27-15/h5-6,8-9,12H,3-4,7H2,1-2H3 |
| InChIKey | NUDJSFQPPRIRSS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.86 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|