C13H15N3O2S — CID 75417159
N'-(1-cyanocyclohexanecarbonyl)thiophene-2-carbohydrazide (PubChem CID 75417159) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is N'-(1-cyanocyclohexanecarbonyl)thiophene-2-carbohydrazide.
| Compound Name | N'-(1-cyanocyclohexanecarbonyl)thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 75417159 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | N'-(1-cyanocyclohexanecarbonyl)thiophene-2-carbohydrazide |
| SMILES | N#CC1(C(=O)NNC(=O)c2cccs2)CCCCC1 |
| InChI | InChI=1S/C13H15N3O2S/c14-9-13(6-2-1-3-7-13)12(18)16-15-11(17)10-5-4-8-19-10/h4-5,8H,1-3,6-7H2,(H,15,17)(H,16,18) |
| InChIKey | WJEOFMQPFLMWGO-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|