C17H17FN2O6S — CID 75417966
5-[4-(5-fluoro-2-methylbenzoyl)piperazin-1-yl]sulfonylfuran-2-carboxylic acid (PubChem CID 75417966) has the molecular formula C17H17FN2O6S and a molecular weight of 396.40 g/mol. Its IUPAC name is 5-[4-(5-fluoro-2-methylbenzoyl)piperazin-1-yl]sulfonylfuran-2-carboxylic acid.
| Compound Name | 5-[4-(5-fluoro-2-methylbenzoyl)piperazin-1-yl]sulfonylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 75417966 |
| Molecular Formula | C17H17FN2O6S |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 5-[4-(5-fluoro-2-methylbenzoyl)piperazin-1-yl]sulfonylfuran-2-carboxylic acid |
| SMILES | Cc1ccc(F)cc1C(=O)N1CCN(S(=O)(=O)c2ccc(C(=O)O)o2)CC1 |
| InChI | InChI=1S/C17H17FN2O6S/c1-11-2-3-12(18)10-13(11)16(21)19-6-8-20(9-7-19)27(24,25)15-5-4-14(26-15)17(22)23/h2-5,10H,6-9H2,1H3,(H,22,23) |
| InChIKey | ZWYCMPNFJCWKHM-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |