C12H20BrNO2S — CID 75420764
1-[(5-bromothiophen-2-yl)methyl-ethylamino]-3-ethoxypropan-2-ol (PubChem CID 75420764) has the molecular formula C12H20BrNO2S and a molecular weight of 322.27 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)methyl-ethylamino]-3-ethoxypropan-2-ol.
| Compound Name | 1-[(5-bromothiophen-2-yl)methyl-ethylamino]-3-ethoxypropan-2-ol |
|---|---|
| PubChem CID | 75420764 |
| Molecular Formula | C12H20BrNO2S |
| Molecular Weight | 322.27 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)methyl-ethylamino]-3-ethoxypropan-2-ol |
| SMILES | CCOCC(O)CN(CC)Cc1ccc(Br)s1 |
| InChI | InChI=1S/C12H20BrNO2S/c1-3-14(7-10(15)9-16-4-2)8-11-5-6-12(13)17-11/h5-6,10,15H,3-4,7-9H2,1-2H3 |
| InChIKey | LNHPIXBDNYGOST-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.27 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |