C16H19FN4O2 — CID 75424250
2-[2-[5-[(3-fluoro-4-methoxyphenyl)methyl]tetrazol-1-yl]ethyl]cyclopentan-1-one (PubChem CID 75424250) has the molecular formula C16H19FN4O2 and a molecular weight of 318.35 g/mol. Its IUPAC name is 2-[2-[5-[(3-fluoro-4-methoxyphenyl)methyl]tetrazol-1-yl]ethyl]cyclopentan-1-one.
| Compound Name | 2-[2-[5-[(3-fluoro-4-methoxyphenyl)methyl]tetrazol-1-yl]ethyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 75424250 |
| Molecular Formula | C16H19FN4O2 |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 2-[2-[5-[(3-fluoro-4-methoxyphenyl)methyl]tetrazol-1-yl]ethyl]cyclopentan-1-one |
| SMILES | COc1ccc(Cc2nnnn2CCC2CCCC2=O)cc1F |
| InChI | InChI=1S/C16H19FN4O2/c1-23-15-6-5-11(9-13(15)17)10-16-18-19-20-21(16)8-7-12-3-2-4-14(12)22/h5-6,9,12H,2-4,7-8,10H2,1H3 |
| InChIKey | CSSKTUFRMVSWCK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |