C13H15F3N4S — CID 75428259
N'-(1-thiophen-2-ylethyl)-N-[4-(trifluoromethyl)pyrimidin-2-yl]ethane-1,2-diamine (PubChem CID 75428259) has the molecular formula C13H15F3N4S and a molecular weight of 316.35 g/mol. Its IUPAC name is N'-(1-thiophen-2-ylethyl)-N-[4-(trifluoromethyl)pyrimidin-2-yl]ethane-1,2-diamine.
| Compound Name | N'-(1-thiophen-2-ylethyl)-N-[4-(trifluoromethyl)pyrimidin-2-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 75428259 |
| Molecular Formula | C13H15F3N4S |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | N'-(1-thiophen-2-ylethyl)-N-[4-(trifluoromethyl)pyrimidin-2-yl]ethane-1,2-diamine |
| SMILES | CC(NCCNc1nccc(C(F)(F)F)n1)c1cccs1 |
| InChI | InChI=1S/C13H15F3N4S/c1-9(10-3-2-8-21-10)17-6-7-19-12-18-5-4-11(20-12)13(14,15)16/h2-5,8-9,17H,6-7H2,1H3,(H,18,19,20) |
| InChIKey | UCVCYKJQKWVMSQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|