C21H29N3O2 — CID 7543261
1-[2-(cyclohexen-1-yl)ethyl]-3-[(3R)-1-(3,4-dimethylphenyl)-5-oxopyrrolidin-3-yl]urea (PubChem CID 7543261) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-3-[(3R)-1-(3,4-dimethylphenyl)-5-oxopyrrolidin-3-yl]urea.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-[(3R)-1-(3,4-dimethylphenyl)-5-oxopyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 7543261 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-[(3R)-1-(3,4-dimethylphenyl)-5-oxopyrrolidin-3-yl]urea |
| SMILES | Cc1ccc(N2C[C@H](NC(=O)NCCC3=CCCCC3)CC2=O)cc1C |
| InChI | InChI=1S/C21H29N3O2/c1-15-8-9-19(12-16(15)2)24-14-18(13-20(24)25)23-21(26)22-11-10-17-6-4-3-5-7-17/h6,8-9,12,18H,3-5,7,10-11,13-14H2,1-2H3,(H2,22,23,26)/t18-/m1/s1 |
| InChIKey | AETMGBPFGAUZHW-GOSISDBHSA-N |
| XLogP | 3.60 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|