C16H13F2N3O — CID 75435269
1-(4-ethynyl-2,6-difluorophenyl)-3-[(6-methyl-2-pyridinyl)methyl]urea (PubChem CID 75435269) has the molecular formula C16H13F2N3O and a molecular weight of 301.30 g/mol. Its IUPAC name is 1-(4-ethynyl-2,6-difluorophenyl)-3-[(6-methyl-2-pyridinyl)methyl]urea.
| Compound Name | 1-(4-ethynyl-2,6-difluorophenyl)-3-[(6-methyl-2-pyridinyl)methyl]urea |
|---|---|
| PubChem CID | 75435269 |
| Molecular Formula | C16H13F2N3O |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 1-(4-ethynyl-2,6-difluorophenyl)-3-[(6-methyl-2-pyridinyl)methyl]urea |
| SMILES | C#Cc1cc(F)c(NC(=O)NCc2cccc(C)n2)c(F)c1 |
| InChI | InChI=1S/C16H13F2N3O/c1-3-11-7-13(17)15(14(18)8-11)21-16(22)19-9-12-6-4-5-10(2)20-12/h1,4-8H,9H2,2H3,(H2,19,21,22) |
| InChIKey | FSNMIAYBXHRJOO-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|