C15H12ClN5O2 — CID 75437642
N-[4-chloro-2-(1H-pyrrole-2-carbonyl)phenyl]-2-(triazol-1-yl)acetamide (PubChem CID 75437642) has the molecular formula C15H12ClN5O2 and a molecular weight of 329.75 g/mol. Its IUPAC name is N-[4-chloro-2-(1H-pyrrole-2-carbonyl)phenyl]-2-(triazol-1-yl)acetamide.
| Compound Name | N-[4-chloro-2-(1H-pyrrole-2-carbonyl)phenyl]-2-(triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 75437642 |
| Molecular Formula | C15H12ClN5O2 |
| Molecular Weight | 329.75 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | N-[4-chloro-2-(1H-pyrrole-2-carbonyl)phenyl]-2-(triazol-1-yl)acetamide |
| SMILES | O=C(Cn1ccnn1)Nc1ccc(Cl)cc1C(=O)c1ccc[nH]1 |
| InChI | InChI=1S/C15H12ClN5O2/c16-10-3-4-12(19-14(22)9-21-7-6-18-20-21)11(8-10)15(23)13-2-1-5-17-13/h1-8,17H,9H2,(H,19,22) |
| InChIKey | UYNXFXBZOQHGIB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.75 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |