C17H21ClN4O2 — CID 50897796
(2S)-2,6-diamino-N-[4-chloro-2-(1H-pyrrole-2-carbonyl)phenyl]hexanamide (PubChem CID 50897796) has the molecular formula C17H21ClN4O2 and a molecular weight of 348.83 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-[4-chloro-2-(1H-pyrrole-2-carbonyl)phenyl]hexanamide.
| Compound Name | (2S)-2,6-diamino-N-[4-chloro-2-(1H-pyrrole-2-carbonyl)phenyl]hexanamide |
|---|---|
| PubChem CID | 50897796 |
| Molecular Formula | C17H21ClN4O2 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | (2S)-2,6-diamino-N-[4-chloro-2-(1H-pyrrole-2-carbonyl)phenyl]hexanamide |
| SMILES | NCCCC[C@H](N)C(=O)Nc1ccc(Cl)cc1C(=O)c1ccc[nH]1 |
| InChI | InChI=1S/C17H21ClN4O2/c18-11-6-7-14(22-17(24)13(20)4-1-2-8-19)12(10-11)16(23)15-5-3-9-21-15/h3,5-7,9-10,13,21H,1-2,4,8,19-20H2,(H,22,24)/t13-/m0/s1 |
| InChIKey | IOAXZYHXIGNIFJ-ZDUSSCGKSA-N |
| XLogP | 2.29 |
| TPSA | 114.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|