C17H18N4O2 — CID 75439311
1,5-dimethyl-4-[(7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]pyrrole-2-carbonitrile (PubChem CID 75439311) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is 1,5-dimethyl-4-[(7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]pyrrole-2-carbonitrile.
| Compound Name | 1,5-dimethyl-4-[(7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]pyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 75439311 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 1,5-dimethyl-4-[(7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)methyl]pyrrole-2-carbonitrile |
| SMILES | Cc1c(CN2CCc3ccc([N+](=O)[O-])cc3C2)cc(C#N)n1C |
| InChI | InChI=1S/C17H18N4O2/c1-12-14(7-17(9-18)19(12)2)10-20-6-5-13-3-4-16(21(22)23)8-15(13)11-20/h3-4,7-8H,5-6,10-11H2,1-2H3 |
| InChIKey | UJOHFQHJSPHISK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 75.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|