C19H24N4O — CID 75441981
4-ethyl-N-(2-pyridin-4-ylphenyl)-1,4-diazepane-1-carboxamide (PubChem CID 75441981) has the molecular formula C19H24N4O and a molecular weight of 324.43 g/mol. Its IUPAC name is 4-ethyl-N-(2-pyridin-4-ylphenyl)-1,4-diazepane-1-carboxamide.
| Compound Name | 4-ethyl-N-(2-pyridin-4-ylphenyl)-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 75441981 |
| Molecular Formula | C19H24N4O |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 4-ethyl-N-(2-pyridin-4-ylphenyl)-1,4-diazepane-1-carboxamide |
| SMILES | CCN1CCCN(C(=O)Nc2ccccc2-c2ccncc2)CC1 |
| InChI | InChI=1S/C19H24N4O/c1-2-22-12-5-13-23(15-14-22)19(24)21-18-7-4-3-6-17(18)16-8-10-20-11-9-16/h3-4,6-11H,2,5,12-15H2,1H3,(H,21,24) |
| InChIKey | GNUQNVRBVWWHKS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |