C18H32N4O3 — CID 75458582
tert-butyl 3-[2-[(1-propylpyrazol-4-yl)amino]propyl]morpholine-4-carboxylate (PubChem CID 75458582) has the molecular formula C18H32N4O3 and a molecular weight of 352.48 g/mol. Its IUPAC name is tert-butyl 3-[2-[(1-propylpyrazol-4-yl)amino]propyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl 3-[2-[(1-propylpyrazol-4-yl)amino]propyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 75458582 |
| Molecular Formula | C18H32N4O3 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.25 |
| IUPAC Name | tert-butyl 3-[2-[(1-propylpyrazol-4-yl)amino]propyl]morpholine-4-carboxylate |
| SMILES | CCCn1cc(NC(C)CC2COCCN2C(=O)OC(C)(C)C)cn1 |
| InChI | InChI=1S/C18H32N4O3/c1-6-7-21-12-15(11-19-21)20-14(2)10-16-13-24-9-8-22(16)17(23)25-18(3,4)5/h11-12,14,16,20H,6-10,13H2,1-5H3 |
| InChIKey | WHQMQBYDBHVGSM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |