C20H32N2O3 — CID 113461855
tert-butyl 3-[2-(2,3-dimethylanilino)propyl]morpholine-4-carboxylate (PubChem CID 113461855) has the molecular formula C20H32N2O3 and a molecular weight of 348.49 g/mol. Its IUPAC name is tert-butyl 3-[2-(2,3-dimethylanilino)propyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl 3-[2-(2,3-dimethylanilino)propyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 113461855 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | tert-butyl 3-[2-(2,3-dimethylanilino)propyl]morpholine-4-carboxylate |
| SMILES | Cc1cccc(NC(C)CC2COCCN2C(=O)OC(C)(C)C)c1C |
| InChI | InChI=1S/C20H32N2O3/c1-14-8-7-9-18(16(14)3)21-15(2)12-17-13-24-11-10-22(17)19(23)25-20(4,5)6/h7-9,15,17,21H,10-13H2,1-6H3 |
| InChIKey | BHAQZGMNEKTCQR-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |