C19H32N2O3S — CID 113461919
tert-butyl 3-[2-(1-thiophen-3-ylpropan-2-ylamino)propyl]morpholine-4-carboxylate (PubChem CID 113461919) has the molecular formula C19H32N2O3S and a molecular weight of 368.54 g/mol. Its IUPAC name is tert-butyl 3-[2-(1-thiophen-3-ylpropan-2-ylamino)propyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl 3-[2-(1-thiophen-3-ylpropan-2-ylamino)propyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 113461919 |
| Molecular Formula | C19H32N2O3S |
| Molecular Weight | 368.54 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | tert-butyl 3-[2-(1-thiophen-3-ylpropan-2-ylamino)propyl]morpholine-4-carboxylate |
| SMILES | CC(Cc1ccsc1)NC(C)CC1COCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H32N2O3S/c1-14(10-16-6-9-25-13-16)20-15(2)11-17-12-23-8-7-21(17)18(22)24-19(3,4)5/h6,9,13-15,17,20H,7-8,10-12H2,1-5H3 |
| InChIKey | MYSXABQLWSIURW-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.54 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |