C21H26N6OS — CID 7546021
4-[(2S,5R)-5-[[1-(2,4-dimethylphenyl)tetrazol-5-yl]sulfanylmethyl]-1,3-oxazolidin-2-yl]-N,N-dimethylaniline (PubChem CID 7546021) has the molecular formula C21H26N6OS and a molecular weight of 410.55 g/mol. Its IUPAC name is 4-[(2S,5R)-5-[[1-(2,4-dimethylphenyl)tetrazol-5-yl]sulfanylmethyl]-1,3-oxazolidin-2-yl]-N,N-dimethylaniline.
| Compound Name | 4-[(2S,5R)-5-[[1-(2,4-dimethylphenyl)tetrazol-5-yl]sulfanylmethyl]-1,3-oxazolidin-2-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 7546021 |
| Molecular Formula | C21H26N6OS |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 4-[(2S,5R)-5-[[1-(2,4-dimethylphenyl)tetrazol-5-yl]sulfanylmethyl]-1,3-oxazolidin-2-yl]-N,N-dimethylaniline |
| SMILES | Cc1ccc(-n2nnnc2SC[C@H]2CN[C@H](c3ccc(N(C)C)cc3)O2)c(C)c1 |
| InChI | InChI=1S/C21H26N6OS/c1-14-5-10-19(15(2)11-14)27-21(23-24-25-27)29-13-18-12-22-20(28-18)16-6-8-17(9-7-16)26(3)4/h5-11,18,20,22H,12-13H2,1-4H3/t18-,20+/m1/s1 |
| InChIKey | YFGKAZUPKAVYCL-QUCCMNQESA-N |
| XLogP | 3.12 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|