C19H22ClN6OS+ — CID 7545167
4-[(2R,5R)-5-[[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylmethyl]-1,3-oxazolidin-3-ium-2-yl]-N,N-dimethylaniline (PubChem CID 7545167) has the molecular formula C19H22ClN6OS+ and a molecular weight of 417.95 g/mol. Its IUPAC name is 4-[(2R,5R)-5-[[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylmethyl]-1,3-oxazolidin-3-ium-2-yl]-N,N-dimethylaniline.
| Compound Name | 4-[(2R,5R)-5-[[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylmethyl]-1,3-oxazolidin-3-ium-2-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 7545167 |
| Molecular Formula | C19H22ClN6OS+ |
| Molecular Weight | 417.95 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 4-[(2R,5R)-5-[[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylmethyl]-1,3-oxazolidin-3-ium-2-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc([C@@H]2[NH2+]C[C@H](CSc3nnnn3-c3ccc(Cl)cc3)O2)cc1 |
| InChI | InChI=1S/C19H21ClN6OS/c1-25(2)15-7-3-13(4-8-15)18-21-11-17(27-18)12-28-19-22-23-24-26(19)16-9-5-14(20)6-10-16/h3-10,17-18,21H,11-12H2,1-2H3/p+1/t17-,18-/m1/s1 |
| InChIKey | XWWFIGUYWMCLOX-QZTJIDSGSA-O |
| XLogP | 2.13 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.95 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|