C20H25N6O2S+ — CID 7544468
4-[(2S,5S)-5-[[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanylmethyl]-1,3-oxazolidin-3-ium-2-yl]-N,N-dimethylaniline (PubChem CID 7544468) has the molecular formula C20H25N6O2S+ and a molecular weight of 413.53 g/mol. Its IUPAC name is 4-[(2S,5S)-5-[[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanylmethyl]-1,3-oxazolidin-3-ium-2-yl]-N,N-dimethylaniline.
| Compound Name | 4-[(2S,5S)-5-[[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanylmethyl]-1,3-oxazolidin-3-ium-2-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 7544468 |
| Molecular Formula | C20H25N6O2S+ |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 4-[(2S,5S)-5-[[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanylmethyl]-1,3-oxazolidin-3-ium-2-yl]-N,N-dimethylaniline |
| SMILES | COc1ccc(-n2nnnc2SC[C@@H]2C[NH2+][C@H](c3ccc(N(C)C)cc3)O2)cc1 |
| InChI | InChI=1S/C20H24N6O2S/c1-25(2)15-6-4-14(5-7-15)19-21-12-18(28-19)13-29-20-22-23-24-26(20)16-8-10-17(27-3)11-9-16/h4-11,18-19,21H,12-13H2,1-3H3/p+1/t18-,19-/m0/s1 |
| InChIKey | VEYISDAEZUIXMD-OALUTQOASA-O |
| XLogP | 1.49 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|