C22H28N6OS — CID 7561493
N,N-dimethyl-4-[(2S,5S)-5-[[1-(4-propan-2-ylphenyl)tetrazol-5-yl]sulfanylmethyl]-1,3-oxazolidin-2-yl]aniline (PubChem CID 7561493) has the molecular formula C22H28N6OS and a molecular weight of 424.57 g/mol. Its IUPAC name is N,N-dimethyl-4-[(2S,5S)-5-[[1-(4-propan-2-ylphenyl)tetrazol-5-yl]sulfanylmethyl]-1,3-oxazolidin-2-yl]aniline.
| Compound Name | N,N-dimethyl-4-[(2S,5S)-5-[[1-(4-propan-2-ylphenyl)tetrazol-5-yl]sulfanylmethyl]-1,3-oxazolidin-2-yl]aniline |
|---|---|
| PubChem CID | 7561493 |
| Molecular Formula | C22H28N6OS |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | N,N-dimethyl-4-[(2S,5S)-5-[[1-(4-propan-2-ylphenyl)tetrazol-5-yl]sulfanylmethyl]-1,3-oxazolidin-2-yl]aniline |
| SMILES | CC(C)c1ccc(-n2nnnc2SC[C@@H]2CN[C@H](c3ccc(N(C)C)cc3)O2)cc1 |
| InChI | InChI=1S/C22H28N6OS/c1-15(2)16-5-11-19(12-6-16)28-22(24-25-26-28)30-14-20-13-23-21(29-20)17-7-9-18(10-8-17)27(3)4/h5-12,15,20-21,23H,13-14H2,1-4H3/t20-,21-/m0/s1 |
| InChIKey | YFIOMYQUFRHKPU-SFTDATJTSA-N |
| XLogP | 3.63 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|