C23H28N5OS+ — CID 7545910
4-[(2R,5S)-5-[(5-cyclopropyl-4-phenyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-oxazolidin-3-ium-2-yl]-N,N-dimethylaniline (PubChem CID 7545910) has the molecular formula C23H28N5OS+ and a molecular weight of 422.58 g/mol. Its IUPAC name is 4-[(2R,5S)-5-[(5-cyclopropyl-4-phenyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-oxazolidin-3-ium-2-yl]-N,N-dimethylaniline.
| Compound Name | 4-[(2R,5S)-5-[(5-cyclopropyl-4-phenyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-oxazolidin-3-ium-2-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 7545910 |
| Molecular Formula | C23H28N5OS+ |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 4-[(2R,5S)-5-[(5-cyclopropyl-4-phenyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-oxazolidin-3-ium-2-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc([C@@H]2[NH2+]C[C@@H](CSc3nnc(C4CC4)n3-c3ccccc3)O2)cc1 |
| InChI | InChI=1S/C23H27N5OS/c1-27(2)18-12-10-17(11-13-18)22-24-14-20(29-22)15-30-23-26-25-21(16-8-9-16)28(23)19-6-4-3-5-7-19/h3-7,10-13,16,20,22,24H,8-9,14-15H2,1-2H3/p+1/t20-,22+/m0/s1 |
| InChIKey | UODBYQKODZBNKI-RBBKRZOGSA-O |
| XLogP | 2.96 |
| TPSA | 59.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|