C22H25N2OS+ — CID 7549714
N,N-dimethyl-4-[(2S,5S)-5-(naphthalen-2-ylsulfanylmethyl)-1,3-oxazolidin-3-ium-2-yl]aniline (PubChem CID 7549714) has the molecular formula C22H25N2OS+ and a molecular weight of 365.52 g/mol. Its IUPAC name is N,N-dimethyl-4-[(2S,5S)-5-(naphthalen-2-ylsulfanylmethyl)-1,3-oxazolidin-3-ium-2-yl]aniline.
| Compound Name | N,N-dimethyl-4-[(2S,5S)-5-(naphthalen-2-ylsulfanylmethyl)-1,3-oxazolidin-3-ium-2-yl]aniline |
|---|---|
| PubChem CID | 7549714 |
| Molecular Formula | C22H25N2OS+ |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | N,N-dimethyl-4-[(2S,5S)-5-(naphthalen-2-ylsulfanylmethyl)-1,3-oxazolidin-3-ium-2-yl]aniline |
| SMILES | CN(C)c1ccc([C@H]2[NH2+]C[C@@H](CSc3ccc4ccccc4c3)O2)cc1 |
| InChI | InChI=1S/C22H24N2OS/c1-24(2)19-10-7-17(8-11-19)22-23-14-20(25-22)15-26-21-12-9-16-5-3-4-6-18(16)13-21/h3-13,20,22-23H,14-15H2,1-2H3/p+1/t20-,22-/m0/s1 |
| InChIKey | XPJYSWDNXMDTDK-UNMCSNQZSA-O |
| XLogP | 3.66 |
| TPSA | 29.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|