C18H32N6O — CID 75462612
4-acetyl-N-butyl-N'-(3-pyrazol-1-ylpropyl)-1,4-diazepane-1-carboximidamide (PubChem CID 75462612) has the molecular formula C18H32N6O and a molecular weight of 348.50 g/mol. Its IUPAC name is 4-acetyl-N-butyl-N'-(3-pyrazol-1-ylpropyl)-1,4-diazepane-1-carboximidamide.
| Compound Name | 4-acetyl-N-butyl-N'-(3-pyrazol-1-ylpropyl)-1,4-diazepane-1-carboximidamide |
|---|---|
| PubChem CID | 75462612 |
| Molecular Formula | C18H32N6O |
| Molecular Weight | 348.50 g/mol |
| Exact Mass | 348.26 |
| IUPAC Name | 4-acetyl-N-butyl-N'-(3-pyrazol-1-ylpropyl)-1,4-diazepane-1-carboximidamide |
| SMILES | CCCCN/C(=N\CCCn1cccn1)N1CCCN(C(C)=O)CC1 |
| InChI | InChI=1S/C18H32N6O/c1-3-4-8-19-18(20-9-5-13-24-14-6-10-21-24)23-12-7-11-22(15-16-23)17(2)25/h6,10,14H,3-5,7-9,11-13,15-16H2,1-2H3,(H,19,20) |
| InChIKey | DJZZQRBLJRSPFL-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 65.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.50 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|