C15H12FNO3 — CID 75462971
(3Z)-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methylidene]-6-fluorochromen-4-one (PubChem CID 75462971) has the molecular formula C15H12FNO3 and a molecular weight of 273.26 g/mol. Its IUPAC name is (3Z)-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methylidene]-6-fluorochromen-4-one.
| Compound Name | (3Z)-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methylidene]-6-fluorochromen-4-one |
|---|---|
| PubChem CID | 75462971 |
| Molecular Formula | C15H12FNO3 |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | (3Z)-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methylidene]-6-fluorochromen-4-one |
| SMILES | Cc1noc(C)c1/C=C1/COc2ccc(F)cc2C1=O |
| InChI | InChI=1S/C15H12FNO3/c1-8-12(9(2)20-17-8)5-10-7-19-14-4-3-11(16)6-13(14)15(10)18/h3-6H,7H2,1-2H3/b10-5- |
| InChIKey | CPMSUGSIPBUMDH-YHYXMXQVSA-N |
| XLogP | 3.09 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|