C20H18FN3O4 — CID 25163555
2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N'-(2-fluorobenzoyl)benzohydrazide (PubChem CID 25163555) has the molecular formula C20H18FN3O4 and a molecular weight of 383.38 g/mol. Its IUPAC name is 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N'-(2-fluorobenzoyl)benzohydrazide.
| Compound Name | 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N'-(2-fluorobenzoyl)benzohydrazide |
|---|---|
| PubChem CID | 25163555 |
| Molecular Formula | C20H18FN3O4 |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N'-(2-fluorobenzoyl)benzohydrazide |
| SMILES | Cc1noc(C)c1COc1ccccc1C(=O)NNC(=O)c1ccccc1F |
| InChI | InChI=1S/C20H18FN3O4/c1-12-16(13(2)28-24-12)11-27-18-10-6-4-8-15(18)20(26)23-22-19(25)14-7-3-5-9-17(14)21/h3-10H,11H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | DJGPBHFIFTWOMB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|