C26H24O5 — CID 75464734
5-[(E)-3-phenylprop-2-enoxy]-3-(3,4,5-trimethoxyphenyl)-1-benzofuran (PubChem CID 75464734) has the molecular formula C26H24O5 and a molecular weight of 416.47 g/mol. Its IUPAC name is 5-[(E)-3-phenylprop-2-enoxy]-3-(3,4,5-trimethoxyphenyl)-1-benzofuran.
| Compound Name | 5-[(E)-3-phenylprop-2-enoxy]-3-(3,4,5-trimethoxyphenyl)-1-benzofuran |
|---|---|
| PubChem CID | 75464734 |
| Molecular Formula | C26H24O5 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 5-[(E)-3-phenylprop-2-enoxy]-3-(3,4,5-trimethoxyphenyl)-1-benzofuran |
| SMILES | COc1cc(-c2coc3ccc(OC/C=C/c4ccccc4)cc23)cc(OC)c1OC |
| InChI | InChI=1S/C26H24O5/c1-27-24-14-19(15-25(28-2)26(24)29-3)22-17-31-23-12-11-20(16-21(22)23)30-13-7-10-18-8-5-4-6-9-18/h4-12,14-17H,13H2,1-3H3/b10-7+ |
| InChIKey | QYGQSTQFOXUQCQ-JXMROGBWSA-N |
| XLogP | 6.22 |
| TPSA | 50.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |