C11H12FNO5S — CID 75466349
ethyl N-[2-(2-fluorophenyl)sulfonylacetyl]carbamate (PubChem CID 75466349) has the molecular formula C11H12FNO5S and a molecular weight of 289.28 g/mol. Its IUPAC name is ethyl N-[2-(2-fluorophenyl)sulfonylacetyl]carbamate.
| Compound Name | ethyl N-[2-(2-fluorophenyl)sulfonylacetyl]carbamate |
|---|---|
| PubChem CID | 75466349 |
| Molecular Formula | C11H12FNO5S |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | ethyl N-[2-(2-fluorophenyl)sulfonylacetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)CS(=O)(=O)c1ccccc1F |
| InChI | InChI=1S/C11H12FNO5S/c1-2-18-11(15)13-10(14)7-19(16,17)9-6-4-3-5-8(9)12/h3-6H,2,7H2,1H3,(H,13,14,15) |
| InChIKey | VGIVUVFWQCCLNA-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |