C20H22N2O4 — CID 75469966
N-(furan-2-ylmethyl)-3-[(7-oxo-2,3,3a,4,5,7a-hexahydropyrano[3,4-b]pyrrol-1-yl)methyl]benzamide (PubChem CID 75469966) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-3-[(7-oxo-2,3,3a,4,5,7a-hexahydropyrano[3,4-b]pyrrol-1-yl)methyl]benzamide.
| Compound Name | N-(furan-2-ylmethyl)-3-[(7-oxo-2,3,3a,4,5,7a-hexahydropyrano[3,4-b]pyrrol-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 75469966 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | N-(furan-2-ylmethyl)-3-[(7-oxo-2,3,3a,4,5,7a-hexahydropyrano[3,4-b]pyrrol-1-yl)methyl]benzamide |
| SMILES | O=C(NCc1ccco1)c1cccc(CN2CCC3CCOC(=O)C32)c1 |
| InChI | InChI=1S/C20H22N2O4/c23-19(21-12-17-5-2-9-25-17)16-4-1-3-14(11-16)13-22-8-6-15-7-10-26-20(24)18(15)22/h1-5,9,11,15,18H,6-8,10,12-13H2,(H,21,23) |
| InChIKey | LJCLZAQKVHPGQT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |